A4368112
4-Fluororesorcinol , 97% , 103068-41-3
Synonym(s):
4-Fluoro-1,3-benzenediol;4-Fluoro-1,3-dihydroxybenzene
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB42.40 | In Stock |
|
| 1G | RMB102.40 | In Stock |
|
| 5g | RMB439.20 | In Stock |
|
| 25g | RMB1983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-100 °C |
| Boiling point: | 240.8±10.0 °C(Predicted) |
| Density | 1.415±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 8.49±0.10(Predicted) |
| color | Brown |
| InChI | InChI=1S/C6H5FO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H |
| InChIKey | XPOIJNIQXJYQOV-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(O)=C1 |
| CAS DataBase Reference | 103068-41-3(CAS DataBase Reference) |
Description and Uses
4-Fluoro-1,3-benzenediol is used in the preparation of fluorescent dyes and indicators.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-34-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2908190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







