A4369312
Fmoc-Nva-OH , ≥98.0%(HPLC) , 135112-28-6
Synonym(s):
Fmoc-L -norvaline;Fmoc-Nva-OH;N-α-Fmoc-L-norvaline
CAS NO.:135112-28-6
Empirical Formula: C20H21NO4
Molecular Weight: 339.39
MDL number: MFCD00155631
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 10g | RMB95.20 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| 100g | RMB508.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-155 °C |
| Boiling point: | 557.9±33.0 °C(Predicted) |
| Density | 1.230±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.91±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 21±1°, c = 2% in DMF |
| BRN | 5883879 |
| Major Application | peptide synthesis |
| InChI | 1S/C20H21NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h3-6,8-11,17-18H,2,7,12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1 |
| InChIKey | JBIJSEUVWWLFGV-SFHVURJKSA-N |
| SMILES | N([C@@H](CCC)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| CAS DataBase Reference | 135112-28-6(CAS DataBase Reference) |
Description and Uses
Fmoc-nva-oh is a tumor targeting Polypeptide and its application in preparation of Polypeptide drug conjugate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







