A4372112
Fmoc-<SC>D</SC>-Phe(4-F)-OH , ≥98% , 177966-64-2
Synonym(s):
Fmoc-4-fluoro-D -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB120.80 | In Stock |
|
| 5G | RMB469.60 | In Stock |
|
| 10g | RMB1028.80 | In Stock |
|
| 25g | RMB2066.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180°C |
| alpha | 35 º (c=1,DMF) |
| Boiling point: | 623.9±55.0 °C(Predicted) |
| Density | 1.2642 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.75±0.10(Predicted) |
| form | Powder |
| color | White |
| optical activity | Consistent with structure |
| InChIKey | IXUMACXMEZBPJG-JOCHJYFZSA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=C(F)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-4-fluoro-d-phenylalanine, is an amino acid derivative, used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29242990 |







