A4373312
2-Furoic hydrazide , 98% , 3326-71-4
Synonym(s):
2-Furoic acid hydrazide;2-Furoylhydrazine
CAS NO.：3326-71-4
Empirical Formula: C5H6N2O2
Molecular Weight: 126.11
MDL number: MFCD00003235
EINECS: 222-046-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB56.80 | In Stock |
|
| 10G | RMB159.20 | In Stock |
|
| 25g | RMB251.20 | In Stock |
|
| 50G | RMB479.20 | In Stock |
|
| 100g | RMB808.00 | In Stock |
|
| 250G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C (lit.) |
| Boiling point: | 279°C(lit.) |
| Density | 1.3541 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 12.18±0.10(Predicted) |
| form | Crystals |
| color | Beige |
| BRN | 114435 |
| InChI | InChI=1S/C5H6N2O2/c6-7-5(8)4-2-1-3-9-4/h1-3H,6H2,(H,7,8) |
| InChIKey | SKTSVWWOAIAIKI-UHFFFAOYSA-N |
| SMILES | O1C=CC=C1C(NN)=O |
| CAS DataBase Reference | 3326-71-4(CAS DataBase Reference) |
Description and Uses
2-Furoic hydrazide (2-Furoylhydrazine) was used to study the Fourier transform infrared spectra, 1H NMR and 13C NMR spectra. It was also used as a reagent for determination of carbohydrates.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | LV1925000 |
| HS Code | 29321900 |
