A4375412
2-(2-Fluorophenyl)ethanol , ≥95.0%(GC) , 50919-06-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB296.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 72°C 1mm |
| Density | 1.045 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.68±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.045 |
| color | Clear colorless |
| InChI | InChI=1S/C8H9FO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | HNIGZVZDWCTFPR-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1F |
| CAS DataBase Reference | 50919-06-7(CAS DataBase Reference) |
Description and Uses
2-(2-Fluorophenyl)ethanol is a useful synthetic intermediate. It is used to prepare phenethyl ester derivative analogs of the C-terminal tetrapeptide of gastrin as potent gastrin antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 36/37/38-21/22-34 |
| Safety Statements | 36/37/39-26-45-27-37-23 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29062990 |
