A4379912
5-Fluoronicotinic Acid , 98% , 402-66-4
Synonym(s):
5-Fluoronicotinic acid
CAS NO.：402-66-4
Empirical Formula: C6H4FNO2
Molecular Weight: 141.1
MDL number: MFCD01318537
EINECS: 674-996-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB87.20 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-198℃ |
| Boiling point: | 272.2±20.0 °C(Predicted) |
| Density | 1.419±0.06 g/cm3(Predicted) |
| RTECS | US5745250 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol. |
| pka | 3.13±0.10(Predicted) |
| form | Powder |
| color | Off-white |
| InChI | InChI=1S/C6H4FNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) |
| InChIKey | BXZSBDDOYIWMGC-UHFFFAOYSA-N |
| SMILES | C1=NC=C(F)C=C1C(O)=O |
| CAS DataBase Reference | 402-66-4(CAS DataBase Reference) |
Description and Uses
5-Fluoronicotinic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
