A4381912
9-Fluorenecarboxylic Acid , ≥97.0%(T) , 1989-33-9
CAS NO.：1989-33-9
Empirical Formula: C14H10O2
Molecular Weight: 210.23
MDL number: MFCD00001136
EINECS: 217-866-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB284.80 | In Stock |
|
| 100G | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-231 °C(lit.) |
| Boiling point: | 309.75°C (rough estimate) |
| Density | 1.1307 (rough estimate) |
| refractive index | 1.5681 (estimate) |
| Flash point: | 230°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.59±0.20(Predicted) |
| form | powder |
| color | Faint beige |
| Water Solubility | insoluble |
| BRN | 1911728 |
| InChI | InChI=1S/C14H10O2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H,(H,15,16) |
| InChIKey | DNVJGJUGFFYUPT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 1989-33-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 9H-fluorene-9-carboxylic acid(1989-33-9) |
| EPA Substance Registry System | 9H-Fluorene-9-carboxylic acid (1989-33-9) |
Description and Uses
9H-Fluorene-9-carboxylic Acid, is a building block in the synthesis of various pharmaceutical and biologically active compounds. It is used in the synthesis of Lomitapide, a drug for the treatment of familial hypercholesterolemia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29163900 |
