A4383812
2-Fluoro-6-nitrophenol , ≥98.0% , 1526-17-6
CAS NO.：1526-17-6
Empirical Formula: C6H4FNO3
Molecular Weight: 157.1
MDL number: MFCD00042446
EINECS: 216-199-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB225.60 | In Stock |
|
| 100g | RMB746.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94°C |
| Boiling point: | 201.5±20.0 °C(Predicted) |
| Density | 1.511±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.67±0.24(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 1870307 |
| InChI | InChI=1S/C6H4FNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
| InChIKey | HIGRXCJEFUYRNW-UHFFFAOYSA-N |
| SMILES | C1(O)=C([N+]([O-])=O)C=CC=C1F |
| CAS DataBase Reference | 1526-17-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Fluoro-6-nitrophenol (1526-17-6) |
Description and Uses
2-Fluoro-6-nitrophenol has antifungal- and high plant-growth-regulating activity.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H301-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29089990 |
