A4387212
9-Fluorenone-4-carboxylic Acid , >98.0%(HPLC)(T) , 6223-83-2
Synonym(s):
9-Fluorenone-4-carboxylic acid
CAS NO.：6223-83-2
Empirical Formula: C14H8O3
Molecular Weight: 224.21
MDL number: MFCD00001145
EINECS: 228-311-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB311.20 | In Stock |
|
| 10g | RMB535.20 | In Stock |
|
| 25G | RMB1143.20 | In Stock |
|
| 100g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-227 °C(lit.) |
| Boiling point: | 476.5±24.0 °C(Predicted) |
| Density | 1.424±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.46±0.20(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 2694801 |
| InChI | InChI=1S/C14H8O3/c15-13-9-5-2-1-4-8(9)12-10(13)6-3-7-11(12)14(16)17/h1-7H,(H,16,17) |
| InChIKey | AFQYQSWTVCNJQT-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C2=C1C=CC=C2C(O)=O |
| CAS DataBase Reference | 6223-83-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 9-Fluorenone-4-carboxylic acid(6223-83-2) |
Description and Uses
4-Carboxy-9-fluorenone can be used for electrophotographic photosensitive member.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2918.30.3000 |
| HazardClass | IRRITANT |
