A4392812
Fenchyl Alcohol , >96.0%(GC) , 1632-73-1
Synonym(s):
(+)-Fenchol;(1R)-1,3,3-Trimethylbicyclo[2.2.1]heptan-2-ol;1,3,3-Trimethyl-2-norbornanol;Fenchyl alcohol
CAS NO.:1632-73-1
Empirical Formula: C10H18O
Molecular Weight: 154.25
MDL number: MFCD00003760
EINECS: 216-639-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB187.20 | In Stock |
|
| 500G | RMB492.80 | In Stock |
|
| 2.5KG | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-46 °C |
| Boiling point: | 201-202 °C(lit.) |
| Density | 0.8704 (rough estimate) |
| refractive index | 1.4723 (estimate) |
| FEMA | 2480 | FENCHYL ALCOHOL |
| Flash point: | 165 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethanol (Sparingly), Methanol (Slightly) |
| pka | 15.38±0.60(Predicted) |
| form | Solid-Liquid Mixture |
| color | White to Almost white |
| Odor | at 100.00 %. camphor borneol pine woody dry sweet lemon |
| Odor Type | camphoreous |
| biological source | synthetic |
| JECFA Number | 1397 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | IAIHUHQCLTYTSF-OYNCUSHFSA-N |
| SMILES | [H][C@]12CC[C@](C)(C1)[C@@H](O)C2(C)C |
| LogP | 2.71 |
| CAS DataBase Reference | 1632-73-1 |
| NIST Chemistry Reference | Fenchyl alcohol(1632-73-1) |
| EPA Substance Registry System | Fenchol (1632-73-1) |
Description and Uses
Fenchyl alcohol has a camphor-like odor with citrus notes and a bitter, lime-like flavor. It is synthesized by reduction of fenchone or from pine terpenes.
Fenchol is a hop-derived aroma compound commonly found in beer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DT5080000 |
| TSCA | TSCA listed |
| HS Code | 2906.19.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







