A4394612
4-Fluoroanthranilic Acid , >98.0%(HPLC)(T) , 446-32-2
Synonym(s):
4-Fluoroanthranilic acid
CAS NO.:446-32-2
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00075553
EINECS: 207-163-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-196 °C (lit.) |
| Boiling point: | 223.67°C (rough estimate) |
| Density | 1.3021 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.88±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 2803665 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) |
| InChIKey | LGPVTNAJFDUWLF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1N |
| CAS DataBase Reference | 446-32-2(CAS DataBase Reference) |
Description and Uses
4-Fluoroanthranilic Acid (cas# 446-32-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



