A4398812
Furoin , >96.0%(GC) , 552-86-3
CAS NO.:552-86-3
Empirical Formula: C10H8O4
Molecular Weight: 192.17
MDL number: MFCD00003246
EINECS: 209-024-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB454.40 | In Stock |
|
| 100g | RMB1278.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-137 °C(lit.) |
| Boiling point: | 248.14°C (rough estimate) |
| Density | 1.0825 (rough estimate) |
| refractive index | 1.4440 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: soluble0.25g/10 mL, clear, colorless to deep brown-yellow |
| form | powder to crystal |
| pka | 11.62±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 383995 |
| InChI | InChI=1S/C10H8O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H |
| InChIKey | MIJRFWVFNKQQDK-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CO1)C(C1=CC=CO1)O |
| CAS DataBase Reference | 552-86-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1,2-di-2-furanyl-2-hydroxy-(552-86-3) |
| EPA Substance Registry System | Ethanone, 1,2-di-2-furanyl-2-hydroxy- (552-86-3) |
Description and Uses
Furoin was used as fluorogenic reagent for the selective and sensitive liquid chromatographic determination of various guanidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | KM5774095 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 552-86-3(Hazardous Substances Data) |




