A4409156
4-(Aminomethyl)phenylboronicacidhydrochloride , ≥97% , 75705-21-4
CAS NO.:75705-21-4
Empirical Formula: C7H11BClNO2
Molecular Weight: 187.43
MDL number: MFCD01632199
EINECS: 672-309-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.00 | In Stock |
|
| 1g | RMB488.00 | In Stock |
|
| 5g | RMB2275.20 | In Stock |
|
| 25g | RMB3791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-250 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Powder |
| color | Pale yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H10BNO2.ClH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4,10-11H,5,9H2;1H |
| InChIKey | HUZNRXFJHYNUMV-UHFFFAOYSA-N |
| SMILES | C1(B(O)O)=CC=C(CN)C=C1.Cl |
| CAS DataBase Reference | 75705-21-4(CAS DataBase Reference) |
Description and Uses
4-Aminomethylphenylboronic acid HCl is the salt form of A292475.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






