A4449012
2-<WBR>Fluoro-<WBR>4-<WBR>(methoxycarbonyl)<WBR>phenylboronic acid pinacol ester , 97% , 603122-79-8
Synonym(s):
Methyl 3-fluoro-4-(4,4,5,5,-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB319.20 | In Stock |
|
| 1G | RMB455.20 | In Stock |
|
| 5G | RMB1765.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-58℃ |
| Boiling point: | 362.5±37.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C14H18BFO4/c1-13(2)14(3,4)20-15(19-13)10-7-6-9(8-11(10)16)12(17)18-5/h6-8H,1-5H3 |
| InChIKey | HPLWCULFGNLCFB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
Description and Uses
2-Fluoro-4-(methoxycarbonyl)phenylboronic acid, pinacol ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







