A4464812
4-fluoro-1H-pyrrolo[2,3-b]pyridine , 97% , 640735-23-5
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB152.80 | In Stock |
|
| 250mg | RMB359.20 | In Stock |
|
| 1G | RMB942.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120°C |
| Density | 1.370±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Dichloromethane, Ethyl Acetate, Methanol, THF |
| pka | 13.28±0.40(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| InChIKey | YZTWCWYRUCKWDR-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=C(F)C=CN=2 |
Description and Uses
4-Fluoro-7-azaindole (cas# 640735-23-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 2933998090 |

![4-fluoro-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/640735-23-5.gif)

![6-Fluoro-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/898746-42-4.gif)
![1H-pyrrolo[2,3-b]pyridine-6-carbonitrile](https://img.chemicalbook.com/CAS/GIF/189882-33-5.gif)

![4-methyl-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/824-24-8.gif)
![1H-Pyrrolo[2,3-b]pyridin-6-amine](https://img.chemicalbook.com/CAS/GIF/145901-11-7.gif)