A4495312
Fmoc-d-cys(acm)-oh , 97% , 168300-88-7
CAS NO.:168300-88-7
Empirical Formula: C21H22N2O5S
Molecular Weight: 414.47
MDL number: MFCD00077053
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB77.60 | In Stock |
|
| 1G | RMB151.20 | In Stock |
|
| 5G | RMB580.96 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145°C |
| Boiling point: | 714.1±60.0 °C(Predicted) |
| Density | 1.327±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.43±0.10(Predicted) |
| form | powder |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | CSMYOORPUGPKAP-LJQANCHMSA-N |
| SMILES | S(CNC(=O)C)C[C@@H](NC(=O)OCC1c2c(cccc2)c3c1cccc3)C(=O)O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 2 |
| Storage Class | 11 - Combustible Solids |







