A4536312
3-Fluoro-5-hydroxyphenylboronic acid , 96% , 871329-82-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB111.20 | In Stock |
|
| 1G | RMB172.80 | In Stock |
|
| 5g | RMB801.60 | In Stock |
|
| 25g | RMB3079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-62 |
| Boiling point: | 380.0±52.0 °C(Predicted) |
| Density | 1.42 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 7.23±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H6BFO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9-11H |
| InChIKey | RMBFBZIEXCTPDB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(O)=CC(F)=C1)(O)O |
| CAS DataBase Reference | 871329-82-7 |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Note | Harmful |
| HS Code | 2931900090 |
