A4547112
Ferulic acid methyl ester , 99% , 2309-07-1
CAS NO.:2309-07-1
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00017208
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB136.00 | In Stock |
|
| 100G | RMB371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-65°C |
| Boiling point: | 163 °C(Press: 1 Torr) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Solid |
| pka | 8.88±0.18(Predicted) |
| color | White to Off-White |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C11H12O4/c1-14-10-7-8(3-5-9(10)12)4-6-11(13)15-2/h3-7,12H,1-2H3 |
| InChIKey | AUJXJFHANFIVKH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C=CC1=CC=C(O)C(OC)=C1 |
| LogP | 2.209 (est) |
| CAS DataBase Reference | 2309-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, methyl ester(2309-07-1) |
Description and Uses
Ferulic Acid Methyl Ester is a derivative of Ferulic Acid (F308900), used as an antioxidant and food preservative. It has less antioxidant capacity than ferulic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | GD9470000 |
| HS Code | 2918999090 |





