A4614612
Genistein , Analysis of standard products, ≥98% , 446-72-0
Synonym(s):
4ʹ,5,7-Trihydroxyisoflavone;4′,5,7-Trihydroxyisoflavone;5,7-Dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;Genistein;Genistein, Soybean - CAS 446-72-0 - Calbiochem
CAS NO.:446-72-0
Empirical Formula: C15H10O5
Molecular Weight: 270.24
MDL number: MFCD00016952
EINECS: 207-174-9
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB65.60 | In Stock |
|
| 1g | RMB1207.20 | In Stock |
|
| 5g | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 297-298 °C |
| Boiling point: | 333.35°C (rough estimate) |
| Density | 1.2319 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: soluble |
| form | powder |
| pka | 6.51±0.20(Predicted) |
| color | off-white |
| biological source | synthetic |
| Water Solubility | insoluble |
| Merck | 14,4391 |
| BRN | 263823 |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS |
| InChI | 1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| InChIKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2=COc3cc(O)cc(O)c3C2=O |
| LogP | 3.114 (est) |
| CAS DataBase Reference | 446-72-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxyphenyl)- (446-72-0) |
Description and Uses
Genistein (446-72-0) is a naturally occurring flavonoid with a wide range of biological actions. Inhibits protein tyrosine kinases including epidermal growth factor receptor kinase.1,2Phytoestrogen3and agonist at GPR304. Displays cancer chemopreventive activity.5
cytotoxic inhibitor of tyrosine kinase and topoisomerase II kinase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-22 |
| Safety Statements | 26-24/25-22 |
| WGK Germany | 3 |
| RTECS | NR2392000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 446-72-0(Hazardous Substances Data) |




