D-(+)-Gluconic acid δ-lactone , USP level , 90-80-2
Synonym(s):
Glucono delta-lactone;Glucono-δ-lactone;Gluconolactone - CAS 90-80-2 - Calbiochem;δ-Gluconolactone;D -(+)-Dextronic acid δ-lactone
CAS NO.：90-80-2
Empirical Formula: C6H10O6
Molecular Weight: 178.14
MDL number: MFCD00006647
EINECS: 202-016-5
| Pack Size | Price | Stock | Quantity |
| 1KG | RMB229.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 160 °C (dec.)(lit.) |
| Boiling point: | 230.35°C (rough estimate) |
| alpha | 65 º (c=1,H2O) |
| Density | 0.6 |
| bulk density | 750kg/m3 |
| refractive index | 63.5 ° (C=10, H2O) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 590g/l Hydrolysis |
| form | Crystalline Powder |
| pka | 12.06±0.60(Predicted) |
| color | White to off-white |
| PH | 3.6 (10g/l, H2O, 20℃) |
| Odor | wh. cryst. powd., pract. odorless |
| biological source | microbial |
| Water Solubility | 500 g/L (20 ºC) |
| Merck | 14,4457 |
| BRN | 83286 |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | SKIN CONDITIONING CHELATING |
| Cosmetic Ingredient Review (CIR) | D-(+)-Glucono-1,5-lactone (90-80-2) |
| InChI | 1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | PHOQVHQSTUBQQK-SQOUGZDYSA-N |
| SMILES | OC[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -2.38 |
| CAS DataBase Reference | 90-80-2(CAS DataBase Reference) |
| NIST Chemistry Reference | D-Gluconic acid, «delta»-lactone(90-80-2) |
| EPA Substance Registry System | .delta.-Gluconolactone (90-80-2) |
Description and Uses
Glucono delta-lactone (C6H10O6), molecular weight 178.14, is an inner ester of gluconic acid. Commonly named gluconolactone, other synonyms include D-gluconic acid delta-lactone, D-glucono- 1, 5-lactone, and D-delta-gluconolactone. Some of its earliest uses as a food ingredient were as a flavoring (e.g., sherbets) and to reduce fat absorption in doughnuts and cones. Glucono deltalactone tastes sweet initially and has a slightly acid-aftertaste.
Geogard(R)Ultra is a synergistic blend of gluconolactone and sodium benzoate. This blend provides broad spectrum protection against product spoilage in a variety of personal care formulations. Product Data Sheet
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21-36/38-46-62-63 |
| Safety Statements | 24/25-53-36/37-26-25 |
| WGK Germany | 3 |
| RTECS | LZ5184000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 90-80-2(Hazardous Substances Data) |
