A4615912
(±)-Gossypol-acetic acid , ≥97%(HPLC) , 12542-36-8
CAS NO.：12542-36-8
Empirical Formula: C32H34O10
Molecular Weight: 578.61
MDL number: MFCD00058385
EINECS: 623-939-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB378.40 | In Stock |
|
| 1G | RMB979.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-168°C |
| storage temp. | −20°C |
| solubility | Soluble in acetone or methanol at 5mg/ml |
| form | Solid |
| color | Yellow to Very Dark Yellow |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | C12C(C(C)C)=C(C(O)=C(C=O)C=1C(O)=C(C1C(C)=CC3C(C(C)C)=C(O)C(O)=C(C=O)C=3C=1O)C(C)=C2)O.C(=O)(O)C |
| LogP | 6.157 (est) |
| CAS DataBase Reference | 12542-36-8(CAS DataBase Reference) |
| EPA Substance Registry System | Gossypol acetic acid (12542-36-8) |
Description and Uses
Gossypol is a mixture of natural polyphenols isolated from the cotton plant. It causes spermatogenesis arrest in humans and also functions as an anti-malarial agent. Antiinflammatory. Anticancer.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| RTECS | MD7360000 |
| HS Code | 29153900 |
