A4618212
D-Galactal , 95% , 21193-75-9
Synonym(s):
1,5-Anhydro-2-deoxy-D -lyxo-hex-1-enitol
CAS NO.:21193-75-9
Empirical Formula: C6H10O4
Molecular Weight: 146.14
MDL number: MFCD00038067
EINECS: 244-264-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB208.80 | In Stock |
|
| 5G | RMB667.20 | In Stock |
|
| 25g | RMB2252.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-103 °C (lit.) |
| Boiling point: | 325.5±42.0 °C(Predicted) |
| Density | 1.414±0.06 g/cm3(Predicted) |
| refractive index | -22 ° (C=1.2, MeOH) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| pka | 12.79±0.60(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D 21.5°, c = 1.2 in methanol |
| BRN | 81690 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6-/m1/s1 |
| InChIKey | YVECGMZCTULTIS-HSUXUTPPSA-N |
| SMILES | OC[C@H]1OC=C[C@@H](O)[C@H]1O |
| CAS DataBase Reference | 21193-75-9(CAS DataBase Reference) |
Description and Uses
D-Galactal is an important building block for both solution- and solid-phase synthesis of oligosaccharides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![2-[2-(2-Azidoethoxy)ethoxy]ethyl 2,3,4,6-Tetra-<i>O</i>-acetyl-<small>D</small>-galactopyranoside](https://img.chemicalbook.com/CAS/GIF/381716-33-2.gif)

