A4619312
Girard’s reagent T , 98% , 123-46-6
Synonym(s):
(Carboxymethyl)trimethylammonium chloride hydrazide;(Hydrazinocarbonylmethyl)trimethylammonium chloride;Acethydrazide trimethylammonium chloride
CAS NO.:123-46-6
Empirical Formula: C5H14N3O.Cl
Molecular Weight: 167.64
MDL number: MFCD00012009
EINECS: 204-629-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB24.00 | In Stock |
|
| 100G | RMB50.40 | In Stock |
|
| 500G | RMB220.00 | In Stock |
|
| 2.5kg | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-192 °C (dec.) (lit.) |
| Density | 1.3799 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | soluble |
| Merck | 14,4429 |
| BRN | 3727163 |
| InChI | InChI=1S/C5H13N3O.ClH/c1-8(2,3)4-5(9)7-6;/h4,6H2,1-3H3;1H |
| InChIKey | YSULOORXQBDPCU-UHFFFAOYSA-N |
| SMILES | [N+](C)(C)(C)CC(=O)NN.[Cl-] |
| CAS DataBase Reference | 123-46-6(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanaminium, 2-hydrazino-N,N,N-trimethyl-2-oxo-, chloride (123-46-6) |
Description and Uses
Girard′s reagent T may be used as a derivatizing reagent for the determination of 5-Formyl-2′-deoxyuridine in cellular DNA samples using liquid chromatography–tandem mass spectrometry (LC–MS/MS) technique. Reducing saccharides can be derivatized by Girard′s reagent T and this can be analyzed by matrix-assisted laser desorption/ionization coupled to time of flight mass spectrometry (MALDI-TOF-MS) technique.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn-F,Xn,F |
| Risk Statements | 44-36/37/38-20/22-11-R44-R36/37/38-R20/22-R11 |
| Safety Statements | 22-24/25-36/37/39-26-16-S36/37/39-S26-S16 |
| WGK Germany | 3 |
| RTECS | CP3150000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |




