PRODUCT Properties
| Melting point: | 290-293 °C (dec.)(lit.) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | SOLUBLE |
| BRN | 3632154 |
| InChI | 1S/2CH5N3.H2O4S/c2*2-1(3)4;1-5(2,3)4/h2*(H5,2,3,4);(H2,1,2,3,4) |
| InChIKey | UYAKTBUPMOOXNW-UHFFFAOYSA-N |
| SMILES | NC(N)=N.NC(N)=N.OS(O)(=O)=O |
| CAS DataBase Reference | 594-14-9(CAS DataBase Reference) |
| EPA Substance Registry System | Guanidine, sulfate (2:1) (594-14-9) |
Description and Uses
The multicomponent condensation of guanidine sulfate salt with H2S and CH2O was studied.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
