A4621612
Ginkgolide A from Ginkgo biloba leaves , Analysis of standard products, ≥98% , 15291-75-5
CAS NO.：15291-75-5
Empirical Formula: C20H24O9
Molecular Weight: 408.4
MDL number: MFCD07437829
EINECS: 604-873-4
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB159.20 | In Stock |
|
| 20MG | RMB214.40 | In Stock |
|
| 50MG | RMB591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280°C (dec.) |
| alpha | D24 -53.4° (c = 1 in ethanol) |
| Boiling point: | 710.1±60.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| RTECS | KC9943000 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in DMSO |
| pka | 11.45±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| λmax | 219nm(EtOH)(lit.) |
| InChIKey | FPUXKXIZEIDQKW-VKMVSBOZSA-N |
| SMILES | C123C(=O)O[C@]4([H])C[C@@H](C(C)(C)C)C5(C41C[C@]1([H])OC(=O)[C@@H](C)[C@@]12O)[C@@](O3)([H])OC([C@@H]5O)=O |
| LogP | 0.159 (est) |
| CAS DataBase Reference | 15291-75-5(CAS DataBase Reference) |
Description and Uses
Family of bioactive terpenes treating cardiovascular and cerebrovascular diseases. Specific platelet activating factor (PAF) antagonists
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29322090 |
