PRODUCT Properties
| Melting point: | 331-333°C |
| Boiling point: | 492.11°C (rough estimate) |
| Density | 0.9967 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.71±0.70(Predicted) |
| color | White to Off-White |
| InChIKey | MPDGHEJMBKOTSU-PMTKVOBESA-N |
| SMILES | [H][C@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)C4[C@@]5(C)CC[C@H](O)C(C)(C)[C@]5([H])CC[C@@]34C)C(O)=O |
| LogP | 6.570 (est) |
| CAS DataBase Reference | 1449-05-4(CAS DataBase Reference) |
Description and Uses
18α-Glycyrrhetinic acid may be used to synthesize:
- 3-keto-18α-glycyrrhetinic acid
- methyl esters of 18α-glycyrrhetinic acid
- methyl esters of 3-keto-18α-glycyrrhetinic acid
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | ection |
| WGK Germany | 3 |
| RTECS | RK0190000 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
