PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Soluble in water |
| BRN | 5199009 |
| InChI | InChI=1/C6H13O9P.Na.H/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h1,3-6,8-11H,2H2,(H2,12,13,14);;/t3-,4+,5+,6+;;/s3 |
| InChIKey | CHIBNKGHYAQTQY-DUMCKRSRSA-L |
| SMILES | [C@@H](O)([C@H](O)COP(O)(O)=O)[C@H](O)[C@@H](O)C=O.[NaH] |&1:0,2,10,12,r| |
| CAS DataBase Reference | 3671-99-6(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucose, 6-(dihydrogen phosphate), disodium salt (3671-99-6) |
Description and Uses
An inhibitor of HXK (hexokinase).
Safety
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | Yes |
| HS Code | 29400000 |
