A4627412
Fmoc-Glu-OAll , 98% , 144120-54-7
Synonym(s):
Fmoc-L -glutamic acid 1-allyl ester;Fmoc-Glu-OAll;N-α-Fmoc-L-glutamic acid α-allyl ester
CAS NO.:144120-54-7
Empirical Formula: C23H23NO6
Molecular Weight: 409.43
MDL number: MFCD00467718
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB57.60 | In Stock |
|
| 5G | RMB236.00 | In Stock |
|
| 25G | RMB952.00 | In Stock |
|
| 100g | RMB2581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122 °C |
| Boiling point: | 652.3±55.0 °C(Predicted) |
| Density | 1.264±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Dimethylformamide |
| pka | 4.46±0.10(Predicted) |
| form | Powder |
| color | Pale brown |
| optical activity | [α]20/D 20.0±2°, c = 1% in DMF |
| BRN | 5460531 |
| Major Application | peptide synthesis |
| InChI | 1S/C23H23NO6/c1-2-13-29-22(27)20(11-12-21(25)26)24-23(28)30-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h2-10,19-20H,1,11-14H2,(H,24,28)(H,25,26)/t20-/m0/s1 |
| InChIKey | ORKKMGRINLTBPC-FQEVSTJZSA-N |
| SMILES | C(OCC=C)(=O)[C@H](CCC(O)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 144120-54-7(CAS DataBase Reference) |
Description and Uses
Allyl esters are useful carboxy protecting groups in the synthesis of various cyclic peptides glycopeptides. Allyl esters are cleaved quantitatively under mild conditions using Pd(0) catalyst.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |




