A4633212
Geranyl chloride , 95% , 5389-87-7
Synonym(s):
trans-1-Chloro-3,7-dimethyl-2,6-octadiene
| Pack Size | Price | Stock | Quantity |
| 5G | RMB604.80 | In Stock |
|
| 25G | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-104 °C/12 mmHg (lit.) |
| Density | 0.931 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C10H17Cl/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | WLAUCMCTKPXDIY-JXMROGBWSA-N |
| SMILES | C(Cl)/C=C(\C)/CC/C=C(/C)\C |
| CAS DataBase Reference | 5389-87-7 |
Description and Uses
Geranyl chloride was used as starting reagent in the synthesis of:
- C25 compound moenocinol
- 2-methyl-6-geranylphenol
- manoalide and seco-manoalide analogs
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | RG5275000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





