A4639312
Glyphosine , 97% , 2439-99-8
Synonym(s):
N-(Carboxymethyl)iminodi(methylphosphinic acid);Glyphosine
CAS NO.:2439-99-8
Empirical Formula: C4H11NO8P2
Molecular Weight: 263.08
MDL number: MFCD00056670
EINECS: 219-468-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263°C |
| Boiling point: | 668.4±65.0 °C(Predicted) |
| Density | 1.952±0.06 g/cm3(Predicted) |
| storage temp. | +2C to +8C |
| solubility | PBS (pH: 7.2):5.0(Max Conc. mg/mL);19.01(Max Conc. mM) |
| pka | pK1 1.42; pK2 2.10; pK3 5.02; pK4 6.40; pK5 11.19(at 25℃) |
| form | Solid |
| color | White |
| Water Solubility | 248g/L(20 ºC) |
| Merck | 13,4526 |
| BRN | 1884944 |
| InChI | InChI=1S/C4H11NO8P2/c6-4(7)1-5(2-14(8,9)10)3-15(11,12)13/h1-3H2,(H,6,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | OXHDYFKENBXUEM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O |
| CAS DataBase Reference | 2439-99-8(CAS DataBase Reference) |
| EPA Substance Registry System | Glyphosine (2439-99-8) |
Description and Uses
Glyphosine was introduced in 1973 and is preferably used in sugar beets. The synthesis starting with glycine uses two equivalents of formaldehyde and of phosphorous trichloride under oxidative conditions. A second derivative of Glyphosate is a cyclic phosphaoxazole being formed from Glyphosate and formaldehyde. This compound is claimed to control the growth of some grasses without dis- coloration or phytotoxicity.
Chemical ripener; plant growth regulator.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-2 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 1 |
| RTECS | MB9120000 |
| TSCA | TSCA listed |
| HS Code | 2922.49.8000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 |
| Toxicity | LD50 orally in rats: 3925 mg/kg; dermally in rabbits: >5010 mg/kg (Ahlrichs) |



