PRODUCT Properties
| Melting point: | 157-159℃ |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder |
| color | white |
| Major Application | peptide synthesis |
| InChI | 1S/C11H14N2O3.C7H8O3S/c12-6-10(14)13-7-11(15)16-8-9-4-2-1-3-5-9;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-8,12H2,(H,13,14);2-5H,1H3,(H,8,9,10) |
| InChIKey | RWBJLSORGVEMHA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(O)(=O)=O.NCC(=O)NCC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 1738-82-5 |
Description and Uses
Gly-Gly benzyl ester p-toluenesulfonate salt may be used as an organic intermediate in peptide synthetic processes.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
