Guanosine-5'-triphosphate disodium salt , 90% , 56001-37-7
Synonym(s):
5′-GTP-Na2;GTP;Guanosine 5′-triphosphate sodium salt hydrate
CAS NO.:56001-37-7
Empirical Formula: C10H14N5Na2O14P3
Molecular Weight: 567.14
MDL number: MFCD00083629
EINECS: 259-940-7
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB44.00 | In Stock |
|
| 250MG | RMB69.60 | In Stock |
|
| 1G | RMB179.20 | In Stock |
|
| 5G | RMB736.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 180°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | PBS (pH 7.2): 10 mg/ml |
| form | Powder |
| color | White |
| Water Solubility | Soluble in water. |
| InChIKey | XIZYETZGWBYYEH-NGPBCCOENA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| |
| CAS DataBase Reference | 56001-37-7(CAS DataBase Reference) |
Description and Uses
Guanosine 5'-triphosphate (5'-GTP) trisodium salt is a G protein (G proteins) signalling activator and a high-energy precursor in the biosynthesis of nucleotide units in DNA and RNA. Guanosine 5'-triphosphate trisodium salt can promote myogenic cell differentiation by upregulating miRNA (miR133a, miR133b) and myogenic regulatory factor expression and by inducing human myogenic precursor cells to release exosomes containing guanosine molecules. Guanosine-5'-triphosphate disodium salt holds promise for research in biosynthesis and skeletal muscle regeneration.
A phosphoryl donor in protein synthesis and signal transduction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |




