PRODUCT Properties
| Boiling point: | 112 °C4.5 mm Hg(lit.) |
| Density | 1.118 g/mL at 25 °C(lit.) |
| vapor pressure | 11.6-82.3Pa at 20-50℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H14O4/c1(9-3-7-5-11-7)2-10-4-8-6-12-8/h7-8H,1-6H2 |
| InChIKey | AOBIOSPNXBMOAT-UHFFFAOYSA-N |
| SMILES | C(OCC1CO1)COCC1CO1 |
| LogP | -0.654 at 20℃ |
| CAS DataBase Reference | 2224-15-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethylene glycol diglycidyl ether(2224-15-9) |
| EPA Substance Registry System | Ethylene glycol diglycidyl ether (2224-15-9) |
Description and Uses
Ethylene Glycol Diglycidyl Ether is commonly added to asorbants because of it high carbon dioxide absorbing capacity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | KH5780000 |
| F | 21 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29109000 |
| Toxicity | LD50 oral in rat: 2500uL/kg |
