A4666212
Glycolaldehyde dimer , 23147-58-2
Synonym(s):
1,4-Dioxane-2,5-diol;2,5-Dihydroxy-1,4-dioxane;Hydroxyacetaldehyde dimer
CAS NO.:23147-58-2
Empirical Formula: C4H8O4
Molecular Weight: 120.1
MDL number: MFCD00012133
EINECS: 607-202-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.80 | In Stock |
|
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB437.60 | In Stock |
|
| 25g | RMB1255.20 | In Stock |
|
| 100g | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~85 °C |
| Boiling point: | 312.4±42.0 °C(Predicted) |
| Density | 1.455 |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 11.97±0.40(Predicted) |
| form | crystalline |
| color | White to Off-White |
| BRN | 506029 |
| InChI | InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
| InChIKey | ATFVTAOSZBVGHC-UHFFFAOYSA-N |
| SMILES | O1CC(O)OCC1O |
| CAS DataBase Reference | 23147-58-2(CAS DataBase Reference) |
Description and Uses
Glycoaldehyde Dimer is derivative of glcoaldehyde, which is the precursor molecule of various significant compounds including amino acid glycine and in the formose reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |





