A4684612
1-Hexyl-3-methylimidazolium chloride , 98% , 171058-17-6
Synonym(s):
HMIMCl
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB145.60 | In Stock |
|
| 100G | RMB582.40 | In Stock |
|
| 500g | RMB2188.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -85 °C |
| Density | 1.0337 |
| refractive index | 1.514-1.518 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow |
| Water Solubility | Insoluble in water. |
| BRN | 8356525 |
| InChI | 1S/C10H19N2.ClH/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-10H,3-7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NKRASMXHSQKLHA-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCn1cc[n+](C)c1 |
| CAS DataBase Reference | 171058-17-6(CAS DataBase Reference) |
Description and Uses
1-n-Hexyl-3-methylimidazolium chloride, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 23-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
