A4689612
1-Hexyl-3-methylimidazolium hexafluorophosphate , 97% , 304680-35-1
Synonym(s):
HMIMPF6
CAS NO.:304680-35-1
Empirical Formula: C10H19F6N2P
Molecular Weight: 312.24
MDL number: MFCD03093296
EINECS: 629-544-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.00 | In Stock |
|
| 10g | RMB80.00 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 50g | RMB247.20 | In Stock |
|
| 100G | RMB455.20 | In Stock |
|
| 500g | RMB1884.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -73.5 °C |
| Density | 1.3045 |
| refractive index | n |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White |
| BRN | 8955409 |
| InChI | InChI=1S/C10H19N2.F6P/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-7(2,3,4,5)6/h8-10H,3-7H2,1-2H3;/q+1;-1 |
| InChIKey | YPWSSSRXUOQNMQ-UHFFFAOYSA-N |
| SMILES | N1(CCCCCC)C=C[N+](C)=C1.[P-](F)(F)(F)(F)(F)F |
| CAS DataBase Reference | 304680-35-1(CAS DataBase Reference) |
Description and Uses
HMIMPF6 can be used as a chelate extraction solvent for divalent metal cations using 4,4,4-trifluoro-1-(2-thienyl)-1,3-butanedione (thenoyltrifluoroacetone, Htta) as an extractant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 9-21 |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |




![[C2MIm]SbF6](https://img.chemicalbook.com/CAS/20180808/GIF/305370-81-4.gif)

