A4691112
4′-Hydroxyvalerophenone , 98% , 2589-71-1
CAS NO.：2589-71-1
Empirical Formula: C11H14O2
Molecular Weight: 178.23
MDL number: MFCD00009719
EINECS: 219-978-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB163.20 | In Stock |
|
| 500G | RMB608.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-65 °C |
| Boiling point: | 182-183 °C/3 mmHg(lit.) |
| Density | 1.0292 (rough estimate) |
| refractive index | 1.5390 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.13±0.15(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C11H14O2/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8,12H,2-4H2,1H3 |
| InChIKey | ZKCJJGOOPOIZTE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(=O)CCCC |
| CAS DataBase Reference | 2589-71-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Pentanone, 1-(4-hydroxyphenyl)-(2589-71-1) |
| EPA Substance Registry System | 1-Pentanone, 1-(4-hydroxyphenyl)- (2589-71-1) |
Description and Uses
4'-Hydroxyvalerophenone is an organic intermediate and pharmaceutical intermediate for the preparation of acylphenoxyacetic acid compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29182900 |
