A4692812
2′-Hydroxy-3-phenylpropiophenone , 97% , 3516-95-8
CAS NO.:3516-95-8
Empirical Formula: C15 H14 O2
Molecular Weight: 226.27
MDL number: MFCD00002221
EINECS: 222-521-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB124.00 | In Stock |
|
| 500g | RMB447.20 | In Stock |
|
| 2.5kg | RMB1560.00 | In Stock |
|
| 250g | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-37 °C(lit.) |
| Boiling point: | 158°C/2mmHg(lit.) |
| Density | 1.150±0.06 g/cm3(Predicted) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 8.07±0.30(Predicted) |
| color | Off-White |
| λmax | 324nm(MeOH)(lit.) |
| InChI | InChI=1S/C15H14O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2 |
| InChIKey | JCPGMXJLFWGRMZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1O)(=O)CCC1=CC=CC=C1 |
| CAS DataBase Reference | 3516-95-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanone, 1-(2-hydroxyphenyl)-3-phenyl- (3516-95-8) |
Description and Uses
2’-Hydroxy-3-phenylpropiophenone (Propafenone EP Impurity A; Propafenone BP Impurity A; Propafenone USP Impurity A) is a metabolite of Propafenone (P757500).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






