A4700412
D-Histidine , 99% , 351-50-8
Synonym(s):
(R)-2-Amino-3-(4-imidazolyl)propionic acid;D -α-Amino-β-(4-imidazolyl)propionic acid
CAS NO.:351-50-8
Empirical Formula: C6H9N3O2
Molecular Weight: 155.15
MDL number: MFCD00065963
EINECS: 206-513-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB169.60 | In Stock |
|
| 100G | RMB572.00 | In Stock |
|
| 500g | RMB2720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280 °C |
| alpha | -12 º (c=11, 6N HCl) |
| Boiling point: | 278.95°C (rough estimate) |
| Density | 1.3092 (rough estimate) |
| refractive index | -13 ° (C=11, 6mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 1 M HCl: soluble |
| pka | 1.91±0.10(Predicted) |
| form | Free-Flowing Powder |
| color | White |
| optical activity | 37.9°(C=1.00g/100mL H2O) |
| Water Solubility | 42 g/L (25 ºC) |
| Merck | 14,4720 |
| BRN | 84089 |
| Stability: | Hygroscopic |
| Major Application | detection peptide synthesis |
| InChI | 1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 |
| InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-N |
| SMILES | N[C@H](Cc1c[nH]cn1)C(O)=O |
| LogP | -1.270 |
| CAS DataBase Reference | 351-50-8(CAS DataBase Reference) |
| EPA Substance Registry System | D-Histidine (351-50-8) |
Description and Uses
D-Histidine is the unnatural, biologically inactive isomer of L-Histidine (H456010). D-histidine is known to inhibit cell division, and is also used by certain types of bacteria (such as Escherichia coli) as a source of L-Histidine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |




