A4701712
1-Hydroxybenzotriazole Monohydrate , ≥97.0% , 123333-53-9
Synonym(s):
HOBt Hydrate
CAS NO.：123333-53-9
Empirical Formula: C6H5N3O
Molecular Weight: 135.13
MDL number: MFCD00065690
EINECS: 602-929-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB61.60 | In Stock |
|
| 500G | RMB218.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-158 °C(lit.) |
| Boiling point: | 248.8°C (rough estimate) |
| Density | 1.065 g/cm |
| refractive index | 1.6910 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMF: 100 mg/mL, clear |
| form | Solid |
| color | White to Off-White |
| Water Solubility | slightly soluble |
| BRN | 4515 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H5N3O.H2O/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;1H2 |
| InChIKey | PJUPKRYGDFTMTM-UHFFFAOYSA-N |
| SMILES | ON1N=NC2C=CC=CC1=2.O |
| CAS DataBase Reference | 123333-53-9(CAS DataBase Reference) |
Description and Uses
1-Hydroxybenzotriazole hydrate can be used as a condensation reagent to prepare:
- Poly-γ-glutamic acid methyl ester from a dimer of γ-glutamic acid.
- Oxadiazoles via cyclo condensation of amidoximes with trifluoroacetic anhydride or benzoic acid derivatives.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H207-H319-H412 |
| Precautionary statements | P210-P212-P230-P233-P280-P370+P380+P375-P501 |
| Hazard Codes | F |
| Risk Statements | 5-11-R5-R11-44-1 |
| Safety Statements | 15-16-35-7/9-33-S7/9-S33-S16-60-37-26 |
| RIDADR | UN 3380 4.1/PG 1 |
| WGK Germany | - |
| F | 4.10-8 |
| Hazard Note | Highly Flammable |
| HazardClass | 4.1 |
| HS Code | 29339980 |
| Excepted Quantities | Not Permitted as Excepted Quantity |
