A4701812
3-Hydroxy-1,2,3-ben zotriazin-4(3H)-one , 98% , 28230-32-2
CAS NO.:28230-32-2
Empirical Formula: C7H5N3O2
Molecular Weight: 163.13
MDL number: MFCD00042803
EINECS: 248-916-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB55.20 | In Stock |
|
| 10g | RMB71.20 | In Stock |
|
| 25G | RMB123.20 | In Stock |
|
| 100G | RMB457.60 | In Stock |
|
| 500g | RMB1812.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-189°C |
| Boiling point: | 290.19°C (rough estimate) |
| Density | 1.041(20.0000℃) |
| refractive index | n |
| Flash point: | 58 °C |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 7.78±0.20(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C7H5N3O2/c11-7-5-3-1-2-4-6(5)8-9-10(7)12/h1-4,12H |
| InChIKey | HJBLUNHMOKFZQX-UHFFFAOYSA-N |
| SMILES | N1C2=CC=CC=C2C(=O)N(O)N=1 |
| CAS DataBase Reference | 28230-32-2(CAS DataBase Reference) |
Description and Uses
Used as additive to improve yields and decrease racemization in DCC-promoted peptide synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS01,GHS07 |
| Signal word | Danger |
| Hazard statements | H201-H335-H319-H315 |
| Precautionary statements | P210-P230-P240-P250-P280-P370+P380-P372-P373-P401-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | T,E,Xi |
| Risk Statements | 20/21-36/37/38-2-1-61 |
| Safety Statements | 53-26-35-36/37-45-37/39-36 |
| RIDADR | UN 3379 3/PG 1 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |





