A4702812
Hyodeoxycholic acid , 98% , 83-49-8
Synonym(s):
3α,6α-Dihydroxy-5β-cholan-24-oic acid
CAS NO.：83-49-8
Empirical Formula: C24H40O4
Molecular Weight: 392.58
MDL number: MFCD00003681
EINECS: 201-483-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB100.80 | In Stock |
|
| 500g | RMB346.40 | In Stock |
|
| 2.5kg | RMB1591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-201 °C (lit.) |
| alpha | D20 +8° (alc) |
| Boiling point: | 437.26°C (rough estimate) |
| Density | 0.9985 (rough estimate) |
| refractive index | 1.4460 (estimate) |
| storage temp. | Refrigerator |
| solubility | Solubility in methanol, very faint turbidity. Slightly soluble in alcohol, acetone, ether and very slightly soluble in chloroform. |
| pka | 4.76±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 5.889mg/L(25 ºC) |
| Merck | 14,4857 |
| InChIKey | DGABKXLVXPYZII-SIBKNCMHSA-N |
| SMILES | C[C@]12CC[C@@H](O)C[C@@]1([H])[C@@H](O)C[C@@]1([H])[C@]3([H])CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@]21[H] |&1:1,4,7,9,12,14,18,20,27,31,r| |
| CAS DataBase Reference | 83-49-8(CAS DataBase Reference) |
Description and Uses
Protected β-Hyodeoxycholic Acid (H998105), a potential bile acid metabolite.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36/37/39-36-22-37 |
| WGK Germany | 3 |
| RTECS | FZ2050000 |
| HS Code | 29181990 |
