A4706012
4-Hydrazinobenzoic acid , 98% , 619-67-0
CAS NO.:619-67-0
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD00007581
EINECS: 210-609-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10g | RMB31.20 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 50g | RMB108.80 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 250g | RMB479.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218 °C (dec.) (lit.) |
| Boiling point: | 274.61°C (rough estimate) |
| Density | 1.2804 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point: | >110° |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Crystalline Powder |
| pka | 4.14±0.10(Predicted) |
| color | Light yellow to light brown |
| BRN | 387378 |
| Stability: | Stable. Combustible. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C7H8N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-4,9H,8H2,(H,10,11) |
| InChIKey | PCNFLKVWBDNNOW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(NN)C=C1 |
| CAS DataBase Reference | 619-67-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-hydrazino- (619-67-0) |
Description and Uses
4-Hydrazinobenzoic acid was used in the synthesis of multi-substituted dihydropyrano[2,3-c]pyrazole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | DH1700000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29280000 |




