A4706312
Harmine , 98% , 442-51-3
Synonym(s):
7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole
CAS NO.:442-51-3
Empirical Formula: C13H12N2O
Molecular Weight: 212.25
MDL number: MFCD00150055
EINECS: 207-131-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB120.80 | In Stock |
|
| 1G | RMB284.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 262-264 °C(lit.) |
| Boiling point: | 352.09°C (rough estimate) |
| Density | 1.1128 (rough estimate) |
| refractive index | 1.6920 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility Slightly soluble in water, ethanol, ether, chloroform |
| form | Crystalline Powder |
| pka | 7.7(at 25℃) |
| color | White to off-white |
| PH Range | Blue 0 uorescence (7.2) to yellow 0 uorescence (8.9) |
| Water Solubility | Soluble in DMSO (100 mM), DMF (~1.5 mg/ml), ethanol (~1.5 mg/ml), and PBS (pH 7.2, ~0.25 mg/ml). Insoluble in water. |
| λmax | 241nm, 301nm, 336nm |
| Merck | 14,4616 |
| BRN | 178813 |
| Major Application | Inks, antitumor agents, inhibition of cell proliferation, blocking breast and prostate cancer cells, tracer for ductal pancreatic cancer, DNA binding properties, treatment of neoplasia, antioxidants, therapy of depression, antileishmanial agent, treatment of parkinsonism, antiAIDS agents, antihypoxia agents, drugs, treatment of dependency disorder, psychiatric and neurological illness, antibiotics, antimalarial agents |
| InChI | 1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 |
| InChIKey | BXNJHAXVSOCGBA-UHFFFAOYSA-N |
| SMILES | [nH]1c2c(c3c1cc(cc3)OC)ccnc2C |
| LogP | 3.560 |
| CAS DataBase Reference | 442-51-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Harmine(442-51-3) |
Description and Uses
antiparkinsonian, CNS stimulant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | Xn |
| Risk Statements | 25-36-20/21/22 |
| Safety Statements | 22-24/25-36/37-26-36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | UV0175000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |




