A4708512
2-Hydroxy-6-methylpyridine , 97% , 3279-76-3
Synonym(s):
6-Methyl-2-pyridinol;6-Methyl-2-pyridone
CAS NO.:3279-76-3
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00456278
EINECS: 221-919-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100G | RMB696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-159 °C (lit.) |
| Boiling point: | 131-133C |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5040 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 12.12±0.10(Predicted) |
| color | White to cream |
| BRN | 107073 |
| InChI | InChI=1S/C6H7NO/c1-5-3-2-4-6(8)7-5/h2-4H,1H3,(H,7,8) |
| InChIKey | JEAVIRYCMBDJIU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC=C1 |
| CAS DataBase Reference | 3279-76-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(1H)-Pyridinone, 6-methyl-(3279-76-3) |
Description and Uses
2-Hydroxy-6-methylpyridine reacts with carboxylic acids RCOOH to give an equilibrium mixture of products M(2)(O(2)CR)(n)(mhp)(4-n) where R = 2-thienyl and phenyl. mhp is the anion formed from deprotonation of 2-hydroxy-6-methylpyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




