A4709312
7-Hydroxy-3,4-dihydro-2(1H)-quinolinone , 97% , 22246-18-0
Synonym(s):
7-Hydroxy-1,2,3,4-tetrahydro-2-quinolinone;7-Hydroxy-3,4-dihydrocarbostyril
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB255.20 | In Stock |
|
| 500g | RMB1159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-237 °C |
| Boiling point: | 403.7±45.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.60±0.20(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C9H9NO2/c11-7-3-1-6-2-4-9(12)10-8(6)5-7/h1,3,5,11H,2,4H2,(H,10,12) |
| InChIKey | LKLSFDWYIBUGNT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(O)=C2)CCC1=O |
| CAS DataBase Reference | 22246-18-0(CAS DataBase Reference) |
Description and Uses
3,4-Dihydro-7-hydroxyquinoline-2(1H)-one (Aripiprazole EP Impurity A) is an antitumor agent. Hydroxyindole analog inhibitor tyrosinase melanoma. This compound is also used in the preparation of aripiprazole (A771000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
