A4709412
6-Hydroxynicotinic Acid , 98% , 5006-66-6
Synonym(s):
2-Hydroxy-5-pyridinecarboxylic acid;6-Hydroxynicotinic acid;6-Hydroxypyridine-3-carboxylic acid
CAS NO.：5006-66-6
Empirical Formula: C6H5NO3
Molecular Weight: 139.11
MDL number: MFCD00006277
EINECS: 225-682-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB84.00 | In Stock |
|
| 100G | RMB204.80 | In Stock |
|
| 500g | RMB1048.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 255.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 3.80±0.50(Predicted) |
| form | Powder |
| color | Off-white to light brown |
| BRN | 472182 |
| InChI | InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | BLHCMGRVFXRYRN-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C=CC=1C(O)=O |
| CAS DataBase Reference | 5006-66-6(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Hydroxynicotinic acid (5006-66-6) |
Description and Uses
Metabolite of nicotinamide. Stimulates adrenocortical secretion
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
