PRODUCT Properties
| Melting point: | ≥300 °C |
| alpha | [α]D20 0±0.5゜(c=2,1mol/l HCl) |
| Boiling point: | 507.6±50.0 °C(Predicted) |
| Density | 1.4269 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly). Aqueous Base (Slightly) |
| form | powder to crystal |
| pka | 1.90±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | 0.2g/L(25 ºC) |
| Merck | 14,4735 |
| BRN | 1728581 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | detection |
| InChI | 1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6+ |
| InChIKey | ZTVZLYBCZNMWCF-OLQVQODUSA-N |
| SMILES | N[C@H](CCSSCC[C@H](N)C(O)=O)C(O)=O |
| CAS DataBase Reference | 870-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | Butanoic acid, 4,4'-dithiobis[2-amino-, (2R,2'R)-rel- (870-93-9) |
Description and Uses
DL-Homocystine is used in the synthesis of potential antitumor agents through inhibition of L-asparagine. There is growing clinical evidence that elevated homocysteine levels are associated with an increased risk of venous and arterial thrombosis.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2930.90.9250 |
| Storage Class | 11 - Combustible Solids |
