A4709712
DL-Homocysteine thiolactone hydrochloride , 98% , 6038-19-3
Synonym(s):
DL -2-Amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride
CAS NO.：6038-19-3
Empirical Formula: C4H8ClNOS
Molecular Weight: 153.63
MDL number: MFCD00012724
EINECS: 227-923-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500g | RMB568.80 | In Stock |
|
| 2.5kg | RMB2767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| color | White |
| Water Solubility | 740.5 g/L (20 C) |
| Merck | 14,4734 |
| BRN | 3562103 |
| InChI | InChI=1S/C4H7NOS.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H |
| InChIKey | ZSEGSUBKDDEALH-UHFFFAOYSA-N |
| SMILES | C1(N)CCSC1=O.Cl |
| CAS DataBase Reference | 6038-19-3(CAS DataBase Reference) |
Description and Uses
DL-Homocysteine thiolactone hydrochloride is used as an intermediate of erdosteine and citiolone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | XN1928400 |
| F | 1-8-9 |
| HS Code | 29349990 |
