A4718812
Hexazinone , Analysis standard product, 98% , 51235-04-2
CAS NO.:51235-04-2
Empirical Formula: C12H20N4O2
Molecular Weight: 252.31
MDL number: MFCD00055526
EINECS: 257-074-4
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-100.5° |
| Boiling point: | 395.49°C (rough estimate) |
| Density | 1.2500 |
| refractive index | 1.6120 (estimate) |
| Flash point: | 11℃ |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) |
| pka | 2.05±0.70(Predicted) |
| form | Powder |
| color | Beige |
| Water Solubility | 33g/L(25 ºC) |
| BRN | 618801 |
| Major Application | agriculture environmental |
| InChI | 1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
| InChIKey | CAWXEEYDBZRFPE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=O)N(C2CCCCC2)C(=O)N1C |
| CAS DataBase Reference | 51235-04-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Triazine-2,4(1h,3h)-dione, 3-cyclohexyl-6-(dimethylamino)-1-methyl-(51235-04-2) |
| EPA Substance Registry System | Hexazinone (51235-04-2) |
Description and Uses
Hexazinone is a white crystalline solid that ispractically odorless. Molecular weight = 252.36; Boilingpoint = decomposes; FreezingMelting point= 115-117℃; .Vapor pressure= 3.0X 10厂' mmHg. Soluble in water.
Hexazinone is a triazine compound used as a preemergence or postemergence herbicide to control many annual grasses and broad-leaved weeds in noncropped land and certain crops such as alfalfa, blueberries, coffee, pecans and sugarcane
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H319-H410 |
| Precautionary statements | P261-P264-P273-P301+P312-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 22-36-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 60-61-45-36/37-16-7 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | XY7850000 |
| TSCA | TSCA listed |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| Hazardous Substances Data | 51235-04-2(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 1690 mg/kg (Neary) |






